C13H18Cl2N2OS — CID 115610639
1-(2,6-dichloro-3-methylphenyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 115610639) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-methylphenyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(2,6-dichloro-3-methylphenyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 115610639 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-(2,6-dichloro-3-methylphenyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2OS/c1-3-18-8-4-7-16-13(19)17-12-10(14)6-5-9(2)11(12)15/h5-6H,3-4,7-8H2,1-2H3,(H2,16,17,19) |
| InChIKey | VIKCQRRPUHFSMI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|