C9H15NO3S2 — CID 64555451
N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 64555451) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 64555451 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(1-hydroxy-2-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCC(C)(CO)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C9H15NO3S2/c1-3-9(2,7-11)10-15(12,13)8-5-4-6-14-8/h4-6,10-11H,3,7H2,1-2H3 |
| InChIKey | VCIJIULTSOUURY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |