C13H23N2O2S2+ — CID 2317336
N-(2-methyl-1-piperidin-1-ium-1-ylpropan-2-yl)thiophene-2-sulfonamide (PubChem CID 2317336) has the molecular formula C13H23N2O2S2+ and a molecular weight of 303.47 g/mol. Its IUPAC name is N-(2-methyl-1-piperidin-1-ium-1-ylpropan-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-methyl-1-piperidin-1-ium-1-ylpropan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2317336 |
| Molecular Formula | C13H23N2O2S2+ |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-(2-methyl-1-piperidin-1-ium-1-ylpropan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)(C[NH+]1CCCCC1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-13(2,11-15-8-4-3-5-9-15)14-19(16,17)12-7-6-10-18-12/h6-7,10,14H,3-5,8-9,11H2,1-2H3/p+1 |
| InChIKey | GXTHCPDSMWAZKG-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |