C10H14N2O2S2 — CID 2322147
N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)thiophene-2-sulfonamide (PubChem CID 2322147) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2322147 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1=NCCCCC1)c1cccs1 |
| InChI | InChI=1S/C10H14N2O2S2/c13-16(14,10-6-4-8-15-10)12-9-5-2-1-3-7-11-9/h4,6,8H,1-3,5,7H2,(H,11,12) |
| InChIKey | NGMSBBDQDHLART-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |