C13H13Cl2NO2S2 — CID 110440536
N-[2-(2,4-dichlorophenyl)propan-2-yl]thiophene-2-sulfonamide (PubChem CID 110440536) has the molecular formula C13H13Cl2NO2S2 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)propan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110440536 |
| Molecular Formula | C13H13Cl2NO2S2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)propan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)(NS(=O)(=O)c1cccs1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2NO2S2/c1-13(2,10-6-5-9(14)8-11(10)15)16-20(17,18)12-4-3-7-19-12/h3-8,16H,1-2H3 |
| InChIKey | WUUHWPAYPIUFLL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |