C8H12N2O2S3 — CID 61121428
2-methyl-2-(thiophen-2-ylsulfonylamino)propanethioamide (PubChem CID 61121428) has the molecular formula C8H12N2O2S3 and a molecular weight of 264.40 g/mol. Its IUPAC name is 2-methyl-2-(thiophen-2-ylsulfonylamino)propanethioamide.
| Compound Name | 2-methyl-2-(thiophen-2-ylsulfonylamino)propanethioamide |
|---|---|
| PubChem CID | 61121428 |
| Molecular Formula | C8H12N2O2S3 |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-methyl-2-(thiophen-2-ylsulfonylamino)propanethioamide |
| SMILES | CC(C)(NS(=O)(=O)c1cccs1)C(N)=S |
| InChI | InChI=1S/C8H12N2O2S3/c1-8(2,7(9)13)10-15(11,12)6-4-3-5-14-6/h3-5,10H,1-2H3,(H2,9,13) |
| InChIKey | GOOYRXZFUGXWJD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|