C14H25N3O2S2 — CID 25048155
N-[1-(4-ethylpiperazin-1-yl)-2-methylpropan-2-yl]thiophene-2-sulfonamide (PubChem CID 25048155) has the molecular formula C14H25N3O2S2 and a molecular weight of 331.51 g/mol. Its IUPAC name is N-[1-(4-ethylpiperazin-1-yl)-2-methylpropan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(4-ethylpiperazin-1-yl)-2-methylpropan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25048155 |
| Molecular Formula | C14H25N3O2S2 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[1-(4-ethylpiperazin-1-yl)-2-methylpropan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCN1CCN(CC(C)(C)NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H25N3O2S2/c1-4-16-7-9-17(10-8-16)12-14(2,3)15-21(18,19)13-6-5-11-20-13/h5-6,11,15H,4,7-10,12H2,1-3H3 |
| InChIKey | MKXATFCKZHIGNZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |