C14H15NO2S2 — CID 42269285
N-[(1-phenylcyclopropyl)methyl]thiophene-2-sulfonamide (PubChem CID 42269285) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[(1-phenylcyclopropyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1-phenylcyclopropyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 42269285 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-[(1-phenylcyclopropyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1(c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C14H15NO2S2/c16-19(17,13-7-4-10-18-13)15-11-14(8-9-14)12-5-2-1-3-6-12/h1-7,10,15H,8-9,11H2 |
| InChIKey | RGIDRTFRQANQRQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |