C16H15ClN2O2S2 — CID 113085492
N-[[1-(6-chloro-1H-indol-3-yl)cyclopropyl]methyl]thiophene-2-sulfonamide (PubChem CID 113085492) has the molecular formula C16H15ClN2O2S2 and a molecular weight of 366.90 g/mol. Its IUPAC name is N-[[1-(6-chloro-1H-indol-3-yl)cyclopropyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-(6-chloro-1H-indol-3-yl)cyclopropyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113085492 |
| Molecular Formula | C16H15ClN2O2S2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | N-[[1-(6-chloro-1H-indol-3-yl)cyclopropyl]methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1(c2c[nH]c3cc(Cl)ccc23)CC1)c1cccs1 |
| InChI | InChI=1S/C16H15ClN2O2S2/c17-11-3-4-12-13(9-18-14(12)8-11)16(5-6-16)10-19-23(20,21)15-2-1-7-22-15/h1-4,7-9,18-19H,5-6,10H2 |
| InChIKey | JYCIEXYNHQWCJL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |