C19H25NO4S2 — CID 110416686
N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]thiophene-2-sulfonamide (PubChem CID 110416686) has the molecular formula C19H25NO4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110416686 |
| Molecular Formula | C19H25NO4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(C2(CNS(=O)(=O)c3cccs3)CCCCC2)cc1OC |
| InChI | InChI=1S/C19H25NO4S2/c1-23-16-9-8-15(13-17(16)24-2)19(10-4-3-5-11-19)14-20-26(21,22)18-7-6-12-25-18/h6-9,12-13,20H,3-5,10-11,14H2,1-2H3 |
| InChIKey | GAJQMJULKDUPBJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |