C12H20N2O3S — CID 64549084
2-amino-N-(1-hydroxy-2-methylbutan-2-yl)-6-methylbenzenesulfonamide (PubChem CID 64549084) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-amino-N-(1-hydroxy-2-methylbutan-2-yl)-6-methylbenzenesulfonamide.
| Compound Name | 2-amino-N-(1-hydroxy-2-methylbutan-2-yl)-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 64549084 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-amino-N-(1-hydroxy-2-methylbutan-2-yl)-6-methylbenzenesulfonamide |
| SMILES | CCC(C)(CO)NS(=O)(=O)c1c(C)cccc1N |
| InChI | InChI=1S/C12H20N2O3S/c1-4-12(3,8-15)14-18(16,17)11-9(2)6-5-7-10(11)13/h5-7,14-15H,4,8,13H2,1-3H3 |
| InChIKey | HNHSGMQXYHVBON-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|