C13H22N2O4S — CID 106505256
3-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,5,6-trimethylbenzenesulfonamide (PubChem CID 106505256) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,5,6-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,5,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106505256 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-amino-N-(1,3-dihydroxy-2-methylpropan-2-yl)-2,5,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NC(C)(CO)CO)c1C |
| InChI | InChI=1S/C13H22N2O4S/c1-8-5-11(14)10(3)12(9(8)2)20(18,19)15-13(4,6-16)7-17/h5,15-17H,6-7,14H2,1-4H3 |
| InChIKey | HCUYTQUUDZPKNN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|