C12H20N2O4S — CID 106505014
3-amino-N-(1,3-dihydroxypropan-2-yl)-2,5,6-trimethylbenzenesulfonamide (PubChem CID 106505014) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-amino-N-(1,3-dihydroxypropan-2-yl)-2,5,6-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(1,3-dihydroxypropan-2-yl)-2,5,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106505014 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-amino-N-(1,3-dihydroxypropan-2-yl)-2,5,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NC(CO)CO)c1C |
| InChI | InChI=1S/C12H20N2O4S/c1-7-4-11(13)9(3)12(8(7)2)19(17,18)14-10(5-15)6-16/h4,10,14-16H,5-6,13H2,1-3H3 |
| InChIKey | XNYJZAVRYCSNLR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|