C11H18N2O4S — CID 65309956
6-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-dimethylbenzenesulfonamide (PubChem CID 65309956) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 6-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 6-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 65309956 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(S(=O)(=O)NC(CO)CO)c1C |
| InChI | InChI=1S/C11H18N2O4S/c1-7-3-4-10(12)11(8(7)2)18(16,17)13-9(5-14)6-15/h3-4,9,13-15H,5-6,12H2,1-2H3 |
| InChIKey | KEJQNKYRHAMCAL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|