C14H23N3O3S — CID 103106560
2-[(6-amino-2,3-dimethylphenyl)sulfonylamino]-N-ethyl-N-methylpropanamide (PubChem CID 103106560) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[(6-amino-2,3-dimethylphenyl)sulfonylamino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[(6-amino-2,3-dimethylphenyl)sulfonylamino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103106560 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[(6-amino-2,3-dimethylphenyl)sulfonylamino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NS(=O)(=O)c1c(N)ccc(C)c1C |
| InChI | InChI=1S/C14H23N3O3S/c1-6-17(5)14(18)11(4)16-21(19,20)13-10(3)9(2)7-8-12(13)15/h7-8,11,16H,6,15H2,1-5H3 |
| InChIKey | QBCOLROUCONGCY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|