C12H18FN3O3S — CID 103106533
2-[(2-amino-6-fluorophenyl)sulfonylamino]-N-ethyl-N-methylpropanamide (PubChem CID 103106533) has the molecular formula C12H18FN3O3S and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[(2-amino-6-fluorophenyl)sulfonylamino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[(2-amino-6-fluorophenyl)sulfonylamino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103106533 |
| Molecular Formula | C12H18FN3O3S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[(2-amino-6-fluorophenyl)sulfonylamino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NS(=O)(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C12H18FN3O3S/c1-4-16(3)12(17)8(2)15-20(18,19)11-9(13)6-5-7-10(11)14/h5-8,15H,4,14H2,1-3H3 |
| InChIKey | GVNKRTDPFCANHN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|