C11H17FN2O3S — CID 64602215
2-amino-6-fluoro-N-(4-methoxybutan-2-yl)benzenesulfonamide (PubChem CID 64602215) has the molecular formula C11H17FN2O3S and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(4-methoxybutan-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-6-fluoro-N-(4-methoxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 64602215 |
| Molecular Formula | C11H17FN2O3S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-amino-6-fluoro-N-(4-methoxybutan-2-yl)benzenesulfonamide |
| SMILES | COCCC(C)NS(=O)(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C11H17FN2O3S/c1-8(6-7-17-2)14-18(15,16)11-9(12)4-3-5-10(11)13/h3-5,8,14H,6-7,13H2,1-2H3 |
| InChIKey | RACRJPRVFKPECG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|