C14H21F2NO3S — CID 3710669
2,6-difluoro-N-(6-hydroxy-6-methylheptan-2-yl)benzenesulfonamide (PubChem CID 3710669) has the molecular formula C14H21F2NO3S and a molecular weight of 321.39 g/mol. Its IUPAC name is 2,6-difluoro-N-(6-hydroxy-6-methylheptan-2-yl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-(6-hydroxy-6-methylheptan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3710669 |
| Molecular Formula | C14H21F2NO3S |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2,6-difluoro-N-(6-hydroxy-6-methylheptan-2-yl)benzenesulfonamide |
| SMILES | CC(CCCC(C)(C)O)NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H21F2NO3S/c1-10(6-5-9-14(2,3)18)17-21(19,20)13-11(15)7-4-8-12(13)16/h4,7-8,10,17-18H,5-6,9H2,1-3H3 |
| InChIKey | SKAMCIPFVYRAIB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |