C12H16F3NO5S2 — CID 100675221
N-[(2R)-5-hydroxypentan-2-yl]-2-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 100675221) has the molecular formula C12H16F3NO5S2 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[(2R)-5-hydroxypentan-2-yl]-2-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | N-[(2R)-5-hydroxypentan-2-yl]-2-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100675221 |
| Molecular Formula | C12H16F3NO5S2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[(2R)-5-hydroxypentan-2-yl]-2-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | C[C@H](CCCO)NS(=O)(=O)c1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO5S2/c1-9(5-4-8-17)16-23(20,21)11-7-3-2-6-10(11)22(18,19)12(13,14)15/h2-3,6-7,9,16-17H,4-5,8H2,1H3/t9-/m1/s1 |
| InChIKey | UURQMDNNDJYPEL-SECBINFHSA-N |
| XLogP | 1.42 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |