C14H23N3O3S — CID 106914039
3-[(6-amino-2,3-dimethylphenyl)sulfonyl-methylamino]-N,2-dimethylpropanamide (PubChem CID 106914039) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-[(6-amino-2,3-dimethylphenyl)sulfonyl-methylamino]-N,2-dimethylpropanamide.
| Compound Name | 3-[(6-amino-2,3-dimethylphenyl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106914039 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[(6-amino-2,3-dimethylphenyl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)S(=O)(=O)c1c(N)ccc(C)c1C |
| InChI | InChI=1S/C14H23N3O3S/c1-9-6-7-12(15)13(11(9)3)21(19,20)17(5)8-10(2)14(18)16-4/h6-7,10H,8,15H2,1-5H3,(H,16,18) |
| InChIKey | FKKZFPWGYGWLQU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|