C10H15ClN2O4S — CID 65310566
3-amino-5-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methylbenzenesulfonamide (PubChem CID 65310566) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 65310566 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-amino-5-chloro-N-(1,3-dihydroxypropan-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NC(CO)CO)cc1Cl |
| InChI | InChI=1S/C10H15ClN2O4S/c1-6-9(11)2-8(3-10(6)12)18(16,17)13-7(4-14)5-15/h2-3,7,13-15H,4-5,12H2,1H3 |
| InChIKey | LGPQIHAQSASRGP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|