C12H18ClN3O3S — CID 43577418
2-[(3-amino-5-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide (PubChem CID 43577418) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-[(3-amino-5-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(3-amino-5-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43577418 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-[(3-amino-5-chloro-4-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NC(C)C(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C12H18ClN3O3S/c1-7-10(13)5-9(6-11(7)14)20(18,19)15-8(2)12(17)16(3)4/h5-6,8,15H,14H2,1-4H3 |
| InChIKey | NVBJJPDLMZDNQT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|