C11H14BrClFN3O3S — CID 103077310
2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N,N-dimethylpropanamide (PubChem CID 103077310) has the molecular formula C11H14BrClFN3O3S and a molecular weight of 402.67 g/mol. Its IUPAC name is 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 103077310 |
| Molecular Formula | C11H14BrClFN3O3S |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]-N,N-dimethylpropanamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F)C(=O)N(C)C |
| InChI | InChI=1S/C11H14BrClFN3O3S/c1-5(11(18)17(2)3)16-21(19,20)7-4-6(13)8(12)10(15)9(7)14/h4-5,16H,15H2,1-3H3 |
| InChIKey | TXAIXQMWUMFIGZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|