C11H17ClN2O5S — CID 107843755
3-amino-5-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 107843755) has the molecular formula C11H17ClN2O5S and a molecular weight of 324.79 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107843755 |
| Molecular Formula | C11H17ClN2O5S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-amino-5-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NC(CO)(CO)CO)cc1Cl |
| InChI | InChI=1S/C11H17ClN2O5S/c1-7-9(12)2-8(3-10(7)13)20(18,19)14-11(4-15,5-16)6-17/h2-3,14-17H,4-6,13H2,1H3 |
| InChIKey | LEAFVTZTVRZXFZ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|