C15H31NO7P+ — CID 175135780
2-[hydroxy-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]propyl]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 175135780) has the molecular formula C15H31NO7P+ and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[hydroxy-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]propyl]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]propyl]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175135780 |
| Molecular Formula | C15H31NO7P+ |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[hydroxy-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]propyl]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CC(=O)OCCOCCOC(C)CP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C15H30NO7P/c1-6-15(17)22-12-10-20-9-11-21-14(2)13-24(18,19)23-8-7-16(3,4)5/h6,14H,1,7-13H2,2-5H3/p+1 |
| InChIKey | SNCXOKOSNFWDFW-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|