C12H25NO5P+ — CID 175314160
2-[hydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 175314160) has the molecular formula C12H25NO5P+ and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175314160 |
| Molecular Formula | C12H25NO5P+ |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OC(C)CP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H24NO5P/c1-10(2)12(14)18-11(3)9-19(15,16)17-8-7-13(4,5)6/h11H,1,7-9H2,2-6H3/p+1 |
| InChIKey | WWUSDJOCCUDHNP-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|