C11H25NO7P+ — CID 175472908
2-hydroxyethyl(trimethyl)azanium;1-phosphonooxyethyl 2-methylprop-2-enoate (PubChem CID 175472908) has the molecular formula C11H25NO7P+ and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;1-phosphonooxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;1-phosphonooxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175472908 |
| Molecular Formula | C11H25NO7P+ |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;1-phosphonooxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OP(=O)(O)O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C6H11O6P.C5H14NO/c1-4(2)6(7)11-5(3)12-13(8,9)10;1-6(2,3)4-5-7/h5H,1H2,2-3H3,(H2,8,9,10);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | CALJBVULNUEUHP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|