C14H22BrO8P — CID 139653010
1-[2-bromoethoxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate (PubChem CID 139653010) has the molecular formula C14H22BrO8P and a molecular weight of 429.20 g/mol. Its IUPAC name is 1-[2-bromoethoxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 1-[2-bromoethoxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139653010 |
| Molecular Formula | C14H22BrO8P |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[2-bromoethoxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OP(=O)(OCCBr)OC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H22BrO8P/c1-9(2)13(16)20-11(5)22-24(18,19-8-7-15)23-12(6)21-14(17)10(3)4/h11-12H,1,3,7-8H2,2,4-6H3 |
| InChIKey | IBRFQIDKWCKURT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|