C24H39O10P — CID 139762333
[1-bis[2-methyl-1-(2-methylprop-2-enoyloxy)propoxy]phosphoryloxy-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 139762333) has the molecular formula C24H39O10P and a molecular weight of 518.54 g/mol. Its IUPAC name is [1-bis[2-methyl-1-(2-methylprop-2-enoyloxy)propoxy]phosphoryloxy-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [1-bis[2-methyl-1-(2-methylprop-2-enoyloxy)propoxy]phosphoryloxy-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139762333 |
| Molecular Formula | C24H39O10P |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [1-bis[2-methyl-1-(2-methylprop-2-enoyloxy)propoxy]phosphoryloxy-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OP(=O)(OC(OC(=O)C(=C)C)C(C)C)OC(OC(=O)C(=C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C24H39O10P/c1-13(2)19(25)29-22(16(7)8)32-35(28,33-23(17(9)10)30-20(26)14(3)4)34-24(18(11)12)31-21(27)15(5)6/h16-18,22-24H,1,3,5H2,2,4,6-12H3 |
| InChIKey | GGWPZPNHTROZJY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|