C15H28O2 — CID 154996770
(2,5-dimethyl-4-propan-2-ylhexan-3-yl) 2-methylprop-2-enoate (PubChem CID 154996770) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2,5-dimethyl-4-propan-2-ylhexan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (2,5-dimethyl-4-propan-2-ylhexan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154996770 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2,5-dimethyl-4-propan-2-ylhexan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(C)C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28O2/c1-9(2)13(10(3)4)14(11(5)6)17-15(16)12(7)8/h9-11,13-14H,7H2,1-6,8H3 |
| InChIKey | BKZMXPHQIOLQGE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|