About 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate
1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate (PubChem CID 139913304) has the molecular formula C27H45O10P
and a molecular weight of 560.62 g/mol. Its IUPAC name is 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate.
Molecular Properties
| Compound Name | 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate |
| PubChem CID | 139913304 |
| Molecular Formula | C27H45O10P |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate |
| SMILES | CCC/C=C(\C)C(=O)OC(C)OP(=O)(OC(C)OC(=O)/C(C)=C/CCC)OC(C)OC(=O)/C(C)=C/CCC |
| InChI | InChI=1S/C27H45O10P/c1-10-13-16-19(4)25(28)32-22(7)35-38(31,36-23(8)33-26(29)20(5)17-14-11-2)37-24(9)34-27(30)21(6)18-15-12-3/h16-18,22-24H,10-15H2,1-9H3/b19-16+,20-17+,21-18+ |
| InChIKey | RITQDZAOYZEBHI-VNQRMFGESA-N |
| XLogP | 7.05 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate?
The IUPAC name of 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate (CID 139913304) is 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate.
What is the SMILES notation for 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate?
The canonical SMILES for 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate is CCC/C=C(\C)C(=O)OC(C)OP(=O)(OC(C)OC(=O)/C(C)=C/CCC)OC(C)OC(=O)/C(C)=C/CCC.
What is the InChIKey of 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate?
The InChIKey is RITQDZAOYZEBHI-VNQRMFGESA-N. The full InChI is InChI=1S/C27H45O10P/c1-10-13-16-19(4)25(28)32-22(7)35-38(31,36-23(8)33-26(29)20(5)17-14-11-2)37-24(9)34-27(30)21(6)18-15-12-3/h16-18,22-24H,10-15H2,1-9H3/b19-16+,20-17+,21-18+.
What are the key properties of 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate?
1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate has a molecular weight of 560.62 g/mol, XLogP of 7.05, 18 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis[1-[(E)-2-methylhex-2-enoyl]oxyethoxy]phosphoryloxy]ethyl (E)-2-methylhex-2-enoate is sourced from PubChem (CID 139913304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).