C19H29O11P — CID 141422606
1-[[(E)-2-hydroperoxy-4-oxohept-5-en-3-yl]oxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate (PubChem CID 141422606) has the molecular formula C19H29O11P and a molecular weight of 464.40 g/mol. Its IUPAC name is 1-[[(E)-2-hydroperoxy-4-oxohept-5-en-3-yl]oxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 1-[[(E)-2-hydroperoxy-4-oxohept-5-en-3-yl]oxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141422606 |
| Molecular Formula | C19H29O11P |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-[[(E)-2-hydroperoxy-4-oxohept-5-en-3-yl]oxy-[1-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OP(=O)(OC(C)OC(=O)C(=C)C)OC(C(=O)/C=C/C)C(C)OO |
| InChI | InChI=1S/C19H29O11P/c1-9-10-16(20)17(13(6)27-23)30-31(24,28-14(7)25-18(21)11(2)3)29-15(8)26-19(22)12(4)5/h9-10,13-15,17,23H,2,4H2,1,3,5-8H3/b10-9+ |
| InChIKey | AIILRHJZZMFIHS-MDZDMXLPSA-N |
| XLogP | 3.47 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|