C10H18O5 — CID 141487666
1-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 141487666) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141487666 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OCCOCCO |
| InChI | InChI=1S/C10H18O5/c1-8(2)10(12)15-9(3)14-7-6-13-5-4-11/h9,11H,1,4-7H2,2-3H3 |
| InChIKey | SYIDQIXBRMUUBB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|