C15H28O7 — CID 19097610
[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-propoxyethyl] 2-methylprop-2-enoate (PubChem CID 19097610) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is [2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-propoxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-propoxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19097610 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-propoxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COCCOCCOCCO)OCCC |
| InChI | InChI=1S/C15H28O7/c1-4-6-21-14(22-15(17)13(2)3)12-20-11-10-19-9-8-18-7-5-16/h14,16H,2,4-12H2,1,3H3 |
| InChIKey | AKHRUXTVOJKMGL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|