C10H18O5 — CID 142665431
4-hydroxy-5-[2-(2-hydroxyethoxy)ethoxy]-2-methylpent-1-en-3-one (PubChem CID 142665431) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 4-hydroxy-5-[2-(2-hydroxyethoxy)ethoxy]-2-methylpent-1-en-3-one.
| Compound Name | 4-hydroxy-5-[2-(2-hydroxyethoxy)ethoxy]-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 142665431 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-hydroxy-5-[2-(2-hydroxyethoxy)ethoxy]-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(O)COCCOCCO |
| InChI | InChI=1S/C10H18O5/c1-8(2)10(13)9(12)7-15-6-5-14-4-3-11/h9,11-12H,1,3-7H2,2H3 |
| InChIKey | MOKUGCDAEDEQEA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|