C16H33NO6P+ — CID 22608904
trimethyl-[9-(2-methylprop-2-enoyloxy)-4-phosphonooxynonyl]azanium (PubChem CID 22608904) has the molecular formula C16H33NO6P+ and a molecular weight of 366.42 g/mol. Its IUPAC name is trimethyl-[9-(2-methylprop-2-enoyloxy)-4-phosphonooxynonyl]azanium.
| Compound Name | trimethyl-[9-(2-methylprop-2-enoyloxy)-4-phosphonooxynonyl]azanium |
|---|---|
| PubChem CID | 22608904 |
| Molecular Formula | C16H33NO6P+ |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | trimethyl-[9-(2-methylprop-2-enoyloxy)-4-phosphonooxynonyl]azanium |
| SMILES | C=C(C)C(=O)OCCCCCC(CCC[N+](C)(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C16H32NO6P/c1-14(2)16(18)22-13-8-6-7-10-15(23-24(19,20)21)11-9-12-17(3,4)5/h15H,1,6-13H2,2-5H3,(H-,19,20,21)/p+1 |
| InChIKey | GNIZVTHBRJHSBE-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|