C17H31NO8P+ — CID 147748302
2-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxy-methoxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 147748302) has the molecular formula C17H31NO8P+ and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxy-methoxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxy-methoxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 147748302 |
| Molecular Formula | C17H31NO8P+ |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxy-methoxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)OP(=O)(OC)OCC[N+](C)(C)C |
| InChI | InChI=1S/C17H31NO8P/c1-13(2)16(19)23-11-15(12-24-17(20)14(3)4)26-27(21,22-8)25-10-9-18(5,6)7/h15H,1,3,9-12H2,2,4-8H3/q+1 |
| InChIKey | HBRZTMGBXOFRNS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|