C19H30I2N2O6P+ — CID 59153675
2-[[1-(2,4-diiodo-6-methylanilino)-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59153675) has the molecular formula C19H30I2N2O6P+ and a molecular weight of 667.24 g/mol. Its IUPAC name is 2-[[1-(2,4-diiodo-6-methylanilino)-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[1-(2,4-diiodo-6-methylanilino)-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59153675 |
| Molecular Formula | C19H30I2N2O6P+ |
| Molecular Weight | 667.24 g/mol |
| Exact Mass | 666.99 |
| IUPAC Name | 2-[[1-(2,4-diiodo-6-methylanilino)-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OCC(CNc1c(C)cc(I)cc1I)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C19H29I2N2O6P/c1-13(2)19(24)27-12-16(29-30(25,26)28-8-7-23(4,5)6)11-22-18-14(3)9-15(20)10-17(18)21/h9-10,16,22H,1,7-8,11-12H2,2-6H3/p+1 |
| InChIKey | XLZYTMCJTVQQDD-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|