C30H51O10P — CID 90186256
2-[bis[1-(2-methylprop-2-enoyloxy)hexan-2-yloxy]phosphoryloxy]hexyl 2-methylprop-2-enoate (PubChem CID 90186256) has the molecular formula C30H51O10P and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[bis[1-(2-methylprop-2-enoyloxy)hexan-2-yloxy]phosphoryloxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis[1-(2-methylprop-2-enoyloxy)hexan-2-yloxy]phosphoryloxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90186256 |
| Molecular Formula | C30H51O10P |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 2-[bis[1-(2-methylprop-2-enoyloxy)hexan-2-yloxy]phosphoryloxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCC)OP(=O)(OC(CCCC)COC(=O)C(=C)C)OC(CCCC)COC(=O)C(=C)C |
| InChI | InChI=1S/C30H51O10P/c1-10-13-16-25(19-35-28(31)22(4)5)38-41(34,39-26(17-14-11-2)20-36-29(32)23(6)7)40-27(18-15-12-3)21-37-30(33)24(8)9/h25-27H,4,6,8,10-21H2,1-3,5,7,9H3 |
| InChIKey | ZRDCVBRSAZGMKW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|