C36H63O13P — CID 90186251
[2-bis[[3-butoxy-1-(2-methylprop-2-enoyloxy)butan-2-yl]oxy]phosphoryloxy-3-butoxybutyl] 2-methylprop-2-enoate (PubChem CID 90186251) has the molecular formula C36H63O13P and a molecular weight of 734.86 g/mol. Its IUPAC name is [2-bis[[3-butoxy-1-(2-methylprop-2-enoyloxy)butan-2-yl]oxy]phosphoryloxy-3-butoxybutyl] 2-methylprop-2-enoate.
| Compound Name | [2-bis[[3-butoxy-1-(2-methylprop-2-enoyloxy)butan-2-yl]oxy]phosphoryloxy-3-butoxybutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90186251 |
| Molecular Formula | C36H63O13P |
| Molecular Weight | 734.86 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | [2-bis[[3-butoxy-1-(2-methylprop-2-enoyloxy)butan-2-yl]oxy]phosphoryloxy-3-butoxybutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(OP(=O)(OC(COC(=O)C(=C)C)C(C)OCCCC)OC(COC(=O)C(=C)C)C(C)OCCCC)C(C)OCCCC |
| InChI | InChI=1S/C36H63O13P/c1-13-16-19-41-28(10)31(22-44-34(37)25(4)5)47-50(40,48-32(23-45-35(38)26(6)7)29(11)42-20-17-14-2)49-33(24-46-36(39)27(8)9)30(12)43-21-18-15-3/h28-33H,4,6,8,13-24H2,1-3,5,7,9-12H3 |
| InChIKey | ZRVDHNOACZNSOP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|