C9H20N2O4P+ — CID 146219697
2-[hydroxy-(2-methylprop-2-enoylamino)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 146219697) has the molecular formula C9H20N2O4P+ and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[hydroxy-(2-methylprop-2-enoylamino)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-(2-methylprop-2-enoylamino)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 146219697 |
| Molecular Formula | C9H20N2O4P+ |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-[hydroxy-(2-methylprop-2-enoylamino)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)NP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C9H19N2O4P/c1-8(2)9(12)10-16(13,14)15-7-6-11(3,4)5/h1,6-7H2,2-5H3,(H-,10,12,13,14)/p+1 |
| InChIKey | JVVMRAHOYXULCF-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|