C19H37NO8P+ — CID 59153685
2-[[1-(2-ethylhexanoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59153685) has the molecular formula C19H37NO8P+ and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[[1-(2-ethylhexanoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[1-(2-ethylhexanoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59153685 |
| Molecular Formula | C19H37NO8P+ |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[[1-(2-ethylhexanoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=CC(=O)OCC(COC(=O)C(CC)CCCC)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C19H36NO8P/c1-7-10-11-16(8-2)19(22)26-15-17(14-25-18(21)9-3)28-29(23,24)27-13-12-20(4,5)6/h9,16-17H,3,7-8,10-15H2,1-2,4-6H3/p+1 |
| InChIKey | MHSYFVWPTXKOCU-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|