C9H17O6P — CID 175583316
[hydroxy(pentan-3-yloxy)phosphoryl]oxymethyl prop-2-enoate (PubChem CID 175583316) has the molecular formula C9H17O6P and a molecular weight of 252.20 g/mol. Its IUPAC name is [hydroxy(pentan-3-yloxy)phosphoryl]oxymethyl prop-2-enoate.
| Compound Name | [hydroxy(pentan-3-yloxy)phosphoryl]oxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 175583316 |
| Molecular Formula | C9H17O6P |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | [hydroxy(pentan-3-yloxy)phosphoryl]oxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOP(=O)(O)OC(CC)CC |
| InChI | InChI=1S/C9H17O6P/c1-4-8(5-2)15-16(11,12)14-7-13-9(10)6-3/h6,8H,3-5,7H2,1-2H3,(H,11,12) |
| InChIKey | BMMFVYPULHWGPV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|