About dimethyl hydrogen phosphate;ethyl prop-2-enoate
dimethyl hydrogen phosphate;ethyl prop-2-enoate (PubChem CID 87182550) has the molecular formula C7H15O6P
and a molecular weight of 226.16 g/mol. Its IUPAC name is dimethyl hydrogen phosphate;ethyl prop-2-enoate.
Molecular Properties
| Compound Name | dimethyl hydrogen phosphate;ethyl prop-2-enoate |
| PubChem CID | 87182550 |
| Molecular Formula | C7H15O6P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | dimethyl hydrogen phosphate;ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC.COP(=O)(O)OC |
| InChI | InChI=1S/C5H8O2.C2H7O4P/c1-3-5(6)7-4-2;1-5-7(3,4)6-2/h3H,1,4H2,2H3;1-2H3,(H,3,4) |
| InChIKey | ZKHFUIIZFCSYQB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl hydrogen phosphate;ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl hydrogen phosphate;ethyl prop-2-enoate?
The IUPAC name of dimethyl hydrogen phosphate;ethyl prop-2-enoate (CID 87182550) is dimethyl hydrogen phosphate;ethyl prop-2-enoate.
What is the SMILES notation for dimethyl hydrogen phosphate;ethyl prop-2-enoate?
The canonical SMILES for dimethyl hydrogen phosphate;ethyl prop-2-enoate is C=CC(=O)OCC.COP(=O)(O)OC.
What is the InChIKey of dimethyl hydrogen phosphate;ethyl prop-2-enoate?
The InChIKey is ZKHFUIIZFCSYQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C2H7O4P/c1-3-5(6)7-4-2;1-5-7(3,4)6-2/h3H,1,4H2,2H3;1-2H3,(H,3,4).
What are the key properties of dimethyl hydrogen phosphate;ethyl prop-2-enoate?
dimethyl hydrogen phosphate;ethyl prop-2-enoate has a molecular weight of 226.16 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl hydrogen phosphate;ethyl prop-2-enoate is sourced from PubChem (CID 87182550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).