C14H27O6P — CID 140975270
10-[hydroxy(methoxy)phosphoryl]oxydecyl prop-2-enoate (PubChem CID 140975270) has the molecular formula C14H27O6P and a molecular weight of 322.34 g/mol. Its IUPAC name is 10-[hydroxy(methoxy)phosphoryl]oxydecyl prop-2-enoate.
| Compound Name | 10-[hydroxy(methoxy)phosphoryl]oxydecyl prop-2-enoate |
|---|---|
| PubChem CID | 140975270 |
| Molecular Formula | C14H27O6P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 10-[hydroxy(methoxy)phosphoryl]oxydecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOP(=O)(O)OC |
| InChI | InChI=1S/C14H27O6P/c1-3-14(15)19-12-10-8-6-4-5-7-9-11-13-20-21(16,17)18-2/h3H,1,4-13H2,2H3,(H,16,17) |
| InChIKey | HEDYZZNUKRBODO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|