C11H15F9N2O — CID 71672282
3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,1-di(propan-2-yl)urea (PubChem CID 71672282) has the molecular formula C11H15F9N2O and a molecular weight of 362.24 g/mol. Its IUPAC name is 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,1-di(propan-2-yl)urea.
| Compound Name | 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 71672282 |
| Molecular Formula | C11H15F9N2O |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H15F9N2O/c1-5(2)22(6(3)4)7(23)21-8(9(12,13)14,10(15,16)17)11(18,19)20/h5-6H,1-4H3,(H,21,23) |
| InChIKey | LPXYEHUQSNCTSF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |