C10H14BrF6NO — CID 71673125
2-bromo-3,3,3-trifluoro-N,N-di(propan-2-yl)-2-(trifluoromethyl)propanamide (PubChem CID 71673125) has the molecular formula C10H14BrF6NO and a molecular weight of 358.12 g/mol. Its IUPAC name is 2-bromo-3,3,3-trifluoro-N,N-di(propan-2-yl)-2-(trifluoromethyl)propanamide.
| Compound Name | 2-bromo-3,3,3-trifluoro-N,N-di(propan-2-yl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71673125 |
| Molecular Formula | C10H14BrF6NO |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-bromo-3,3,3-trifluoro-N,N-di(propan-2-yl)-2-(trifluoromethyl)propanamide |
| SMILES | CC(C)N(C(=O)C(Br)(C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H14BrF6NO/c1-5(2)18(6(3)4)7(19)8(11,9(12,13)14)10(15,16)17/h5-6H,1-4H3 |
| InChIKey | YRGOUEYNLZDJII-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|