C10H13BrF5NO2 — CID 114038289
N-(4-bromo-3-oxobutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide (PubChem CID 114038289) has the molecular formula C10H13BrF5NO2 and a molecular weight of 354.11 g/mol. Its IUPAC name is N-(4-bromo-3-oxobutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide.
| Compound Name | N-(4-bromo-3-oxobutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 114038289 |
| Molecular Formula | C10H13BrF5NO2 |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N-(4-bromo-3-oxobutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropanamide |
| SMILES | CC(C)N(CCC(=O)CBr)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13BrF5NO2/c1-6(2)17(4-3-7(18)5-11)8(19)9(12,13)10(14,15)16/h6H,3-5H2,1-2H3 |
| InChIKey | YSCABWBNFLKGHO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|