C13H22F5NO — CID 71671754
2,2,3,3,3-pentafluoro-N,N-bis(3-methylbutyl)propanamide (PubChem CID 71671754) has the molecular formula C13H22F5NO and a molecular weight of 303.32 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N,N-bis(3-methylbutyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N,N-bis(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 71671754 |
| Molecular Formula | C13H22F5NO |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N,N-bis(3-methylbutyl)propanamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H22F5NO/c1-9(2)5-7-19(8-6-10(3)4)11(20)12(14,15)13(16,17)18/h9-10H,5-8H2,1-4H3 |
| InChIKey | XMRQKLMAKAAAIW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|