About 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate
2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate (PubChem CID 61066672) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate.
Analyze 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate?
The IUPAC name of 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate (CID 61066672) is 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate.
What is the SMILES notation for 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate?
The canonical SMILES for 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate is CC(C)CCN(C)C(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate?
The InChIKey is LZQIHSYAXQHUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-7(2)4-5-13(3)8(14)15-6-9(10,11)12/h7H,4-6H2,1-3H3.
What are the key properties of 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate?
2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate has a molecular weight of 227.23 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl N-methyl-N-(3-methylbutyl)carbamate is sourced from PubChem (CID 61066672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).